C15H28N2O2 — CID 114828666
1-amino-3-ethoxy-2,2-dimethyl-N-propan-2-yl-N-prop-2-enylcyclobutane-1-carboxamide (PubChem CID 114828666) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-amino-3-ethoxy-2,2-dimethyl-N-propan-2-yl-N-prop-2-enylcyclobutane-1-carboxamide.
| Compound Name | 1-amino-3-ethoxy-2,2-dimethyl-N-propan-2-yl-N-prop-2-enylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 114828666 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-amino-3-ethoxy-2,2-dimethyl-N-propan-2-yl-N-prop-2-enylcyclobutane-1-carboxamide |
| SMILES | C=CCN(C(=O)C1(N)CC(OCC)C1(C)C)C(C)C |
| InChI | InChI=1S/C15H28N2O2/c1-7-9-17(11(3)4)13(18)15(16)10-12(19-8-2)14(15,5)6/h7,11-12H,1,8-10,16H2,2-6H3 |
| InChIKey | OGTOGUCFVCUXBR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|