C11H22N2O3 — CID 114828939
1-amino-3-ethoxy-N-methoxy-N,2,2-trimethylcyclobutane-1-carboxamide (PubChem CID 114828939) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-amino-3-ethoxy-N-methoxy-N,2,2-trimethylcyclobutane-1-carboxamide.
| Compound Name | 1-amino-3-ethoxy-N-methoxy-N,2,2-trimethylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 114828939 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 1-amino-3-ethoxy-N-methoxy-N,2,2-trimethylcyclobutane-1-carboxamide |
| SMILES | CCOC1CC(N)(C(=O)N(C)OC)C1(C)C |
| InChI | InChI=1S/C11H22N2O3/c1-6-16-8-7-11(12,10(8,2)3)9(14)13(4)15-5/h8H,6-7,12H2,1-5H3 |
| InChIKey | YNWUEZXMONCTEG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|