C18H26O3 — CID 11483155
(2Z)-3-[2-(furan-3-yl)ethyl]-2-(3-propan-2-yloxypropylidene)cyclohexan-1-one (PubChem CID 11483155) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (2Z)-3-[2-(furan-3-yl)ethyl]-2-(3-propan-2-yloxypropylidene)cyclohexan-1-one.
| Compound Name | (2Z)-3-[2-(furan-3-yl)ethyl]-2-(3-propan-2-yloxypropylidene)cyclohexan-1-one |
|---|---|
| PubChem CID | 11483155 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (2Z)-3-[2-(furan-3-yl)ethyl]-2-(3-propan-2-yloxypropylidene)cyclohexan-1-one |
| SMILES | CC(C)OCC/C=C1\C(=O)CCCC1CCc1ccoc1 |
| InChI | InChI=1S/C18H26O3/c1-14(2)21-11-4-6-17-16(5-3-7-18(17)19)9-8-15-10-12-20-13-15/h6,10,12-14,16H,3-5,7-9,11H2,1-2H3/b17-6- |
| InChIKey | QANSQYMNTWHEMU-FMQZQXMHSA-N |
| XLogP | 4.32 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|