C23H36O3 — CID 162998814
propan-2-yl 3-[(2S,3R)-2-[2-(furan-3-yl)ethyl]-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propanoate (PubChem CID 162998814) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is propan-2-yl 3-[(2S,3R)-2-[2-(furan-3-yl)ethyl]-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propanoate.
| Compound Name | propan-2-yl 3-[(2S,3R)-2-[2-(furan-3-yl)ethyl]-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propanoate |
|---|---|
| PubChem CID | 162998814 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | propan-2-yl 3-[(2S,3R)-2-[2-(furan-3-yl)ethyl]-2,3-dimethyl-6-propan-2-ylidenecyclohexyl]propanoate |
| SMILES | CC(C)=C1CC[C@@H](C)[C@](C)(CCc2ccoc2)C1CCC(=O)OC(C)C |
| InChI | InChI=1S/C23H36O3/c1-16(2)20-8-7-18(5)23(6,13-11-19-12-14-25-15-19)21(20)9-10-22(24)26-17(3)4/h12,14-15,17-18,21H,7-11,13H2,1-6H3/t18-,21?,23+/m1/s1 |
| InChIKey | WXJSQSRTYFZBJE-VJEWXZQSSA-N |
| XLogP | 6.33 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|