C16H32O3Si — CID 11483446
ethyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enoate (PubChem CID 11483446) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is ethyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enoate.
| Compound Name | ethyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enoate |
|---|---|
| PubChem CID | 11483446 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | ethyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methylhept-3-enoate |
| SMILES | CCOC(=O)C/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H32O3Si/c1-9-18-15(17)12-10-11-14(13(2)3)19-20(7,8)16(4,5)6/h10-11,13-14H,9,12H2,1-8H3/b11-10+/t14-/m1/s1 |
| InChIKey | NUCKGSYVXVQKQJ-PLSXKVAHSA-N |
| XLogP | 4.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|