C14H18FNO — CID 114834992
2-[1-(2-fluorophenyl)-2-hydroxypropan-2-yl]pentanenitrile (PubChem CID 114834992) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)-2-hydroxypropan-2-yl]pentanenitrile.
| Compound Name | 2-[1-(2-fluorophenyl)-2-hydroxypropan-2-yl]pentanenitrile |
|---|---|
| PubChem CID | 114834992 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-[1-(2-fluorophenyl)-2-hydroxypropan-2-yl]pentanenitrile |
| SMILES | CCCC(C#N)C(C)(O)Cc1ccccc1F |
| InChI | InChI=1S/C14H18FNO/c1-3-6-12(10-16)14(2,17)9-11-7-4-5-8-13(11)15/h4-5,7-8,12,17H,3,6,9H2,1-2H3 |
| InChIKey | UVNJINPDYSXBJG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |