C16H23FN2 — CID 106228166
3-(2-fluorophenyl)-2-N-hex-1-yn-3-yl-2-methylpropane-1,2-diamine (PubChem CID 106228166) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-2-N-hex-1-yn-3-yl-2-methylpropane-1,2-diamine.
| Compound Name | 3-(2-fluorophenyl)-2-N-hex-1-yn-3-yl-2-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 106228166 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 3-(2-fluorophenyl)-2-N-hex-1-yn-3-yl-2-methylpropane-1,2-diamine |
| SMILES | C#CC(CCC)NC(C)(CN)Cc1ccccc1F |
| InChI | InChI=1S/C16H23FN2/c1-4-8-14(5-2)19-16(3,12-18)11-13-9-6-7-10-15(13)17/h2,6-7,9-10,14,19H,4,8,11-12,18H2,1,3H3 |
| InChIKey | XFHSJXGOJJNSBX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|