C14H20Cl2N4 — CID 11483869
[4-[3-(3-methylimidazol-3-ium-1-yl)pyrrolidin-1-yl]phenyl]azanium dichloride (PubChem CID 11483869) has the molecular formula C14H20Cl2N4 and a molecular weight of 315.25 g/mol. Its IUPAC name is [4-[3-(3-methylimidazol-3-ium-1-yl)pyrrolidin-1-yl]phenyl]azanium dichloride.
| Compound Name | [4-[3-(3-methylimidazol-3-ium-1-yl)pyrrolidin-1-yl]phenyl]azanium dichloride |
|---|---|
| PubChem CID | 11483869 |
| Molecular Formula | C14H20Cl2N4 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [4-[3-(3-methylimidazol-3-ium-1-yl)pyrrolidin-1-yl]phenyl]azanium dichloride |
| SMILES | C[n+]1ccn(C2CCN(c3ccc([NH3+])cc3)C2)c1.[Cl-].[Cl-] |
| InChI | InChI=1S/C14H19N4.2ClH/c1-16-8-9-18(11-16)14-6-7-17(10-14)13-4-2-12(15)3-5-13;;/h2-5,8-9,11,14H,6-7,10,15H2,1H3;2*1H/q+1;;/p-1 |
| InChIKey | MJDGEEQIHHMWKP-UHFFFAOYSA-M |
| XLogP | -5.35 |
| TPSA | 39.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | -5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|