C35H42N8O2+2 — CID 87205472
2-methyl-4,6-bis[4-[3-(3-methylimidazol-3-ium-1-yl)pyrrolidin-1-yl]anilino]benzene-1,3-diol (PubChem CID 87205472) has the molecular formula C35H42N8O2+2 and a molecular weight of 606.77 g/mol. Its IUPAC name is 2-methyl-4,6-bis[4-[3-(3-methylimidazol-3-ium-1-yl)pyrrolidin-1-yl]anilino]benzene-1,3-diol.
| Compound Name | 2-methyl-4,6-bis[4-[3-(3-methylimidazol-3-ium-1-yl)pyrrolidin-1-yl]anilino]benzene-1,3-diol |
|---|---|
| PubChem CID | 87205472 |
| Molecular Formula | C35H42N8O2+2 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.34 |
| IUPAC Name | 2-methyl-4,6-bis[4-[3-(3-methylimidazol-3-ium-1-yl)pyrrolidin-1-yl]anilino]benzene-1,3-diol |
| SMILES | Cc1c(O)c(Nc2ccc(N3CCC(n4cc[n+](C)c4)C3)cc2)cc(Nc2ccc(N3CCC(n4cc[n+](C)c4)C3)cc2)c1O |
| InChI | InChI=1S/C35H40N8O2/c1-25-34(44)32(36-26-4-8-28(9-5-26)40-14-12-30(21-40)42-18-16-38(2)23-42)20-33(35(25)45)37-27-6-10-29(11-7-27)41-15-13-31(22-41)43-19-17-39(3)24-43/h4-11,16-20,23-24,30-31,36-37H,12-15,21-22H2,1-3H3/p+2 |
| InChIKey | BNOSZBOJDXBXSX-UHFFFAOYSA-P |
| XLogP | 5.05 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|