C20H25ClFN3 — CID 163233643
3-chloro-1-N-[4-(4,4-dimethylpiperidin-1-yl)phenyl]-4-fluoro-5-methylbenzene-1,2-diamine (PubChem CID 163233643) has the molecular formula C20H25ClFN3 and a molecular weight of 361.89 g/mol. Its IUPAC name is 3-chloro-1-N-[4-(4,4-dimethylpiperidin-1-yl)phenyl]-4-fluoro-5-methylbenzene-1,2-diamine.
| Compound Name | 3-chloro-1-N-[4-(4,4-dimethylpiperidin-1-yl)phenyl]-4-fluoro-5-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 163233643 |
| Molecular Formula | C20H25ClFN3 |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 3-chloro-1-N-[4-(4,4-dimethylpiperidin-1-yl)phenyl]-4-fluoro-5-methylbenzene-1,2-diamine |
| SMILES | Cc1cc(Nc2ccc(N3CCC(C)(C)CC3)cc2)c(N)c(Cl)c1F |
| InChI | InChI=1S/C20H25ClFN3/c1-13-12-16(19(23)17(21)18(13)22)24-14-4-6-15(7-5-14)25-10-8-20(2,3)9-11-25/h4-7,12,24H,8-11,23H2,1-3H3 |
| InChIKey | XCXFWQWLRZSHLO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|