C17H21NO5 — CID 11484005
(1S,2S,6S,7R,8S)-9-benzyl-7-(hydroxymethyl)-4,4-dimethyl-3,5,11-trioxa-9-azatricyclo[6.3.0.02,6]undecan-10-one (PubChem CID 11484005) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is (1S,2S,6S,7R,8S)-9-benzyl-7-(hydroxymethyl)-4,4-dimethyl-3,5,11-trioxa-9-azatricyclo[6.3.0.02,6]undecan-10-one.
| Compound Name | (1S,2S,6S,7R,8S)-9-benzyl-7-(hydroxymethyl)-4,4-dimethyl-3,5,11-trioxa-9-azatricyclo[6.3.0.02,6]undecan-10-one |
|---|---|
| PubChem CID | 11484005 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (1S,2S,6S,7R,8S)-9-benzyl-7-(hydroxymethyl)-4,4-dimethyl-3,5,11-trioxa-9-azatricyclo[6.3.0.02,6]undecan-10-one |
| SMILES | CC1(C)O[C@@H]2[C@H]3OC(=O)N(Cc4ccccc4)[C@H]3[C@H](CO)[C@@H]2O1 |
| InChI | InChI=1S/C17H21NO5/c1-17(2)22-13-11(9-19)12-14(15(13)23-17)21-16(20)18(12)8-10-6-4-3-5-7-10/h3-7,11-15,19H,8-9H2,1-2H3/t11-,12-,13-,14-,15-/m0/s1 |
| InChIKey | UDJWRTWXTVYFIS-YTFOTSKYSA-N |
| XLogP | 1.52 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |