C15H17F3N2OSi — CID 11484203
trimethyl-(2,2,2-trifluoro-1,1-dipyridin-2-ylethoxy)silane (PubChem CID 11484203) has the molecular formula C15H17F3N2OSi and a molecular weight of 326.39 g/mol. Its IUPAC name is trimethyl-(2,2,2-trifluoro-1,1-dipyridin-2-ylethoxy)silane.
| Compound Name | trimethyl-(2,2,2-trifluoro-1,1-dipyridin-2-ylethoxy)silane |
|---|---|
| PubChem CID | 11484203 |
| Molecular Formula | C15H17F3N2OSi |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | trimethyl-(2,2,2-trifluoro-1,1-dipyridin-2-ylethoxy)silane |
| SMILES | C[Si](C)(C)OC(c1ccccn1)(c1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C15H17F3N2OSi/c1-22(2,3)21-14(15(16,17)18,12-8-4-6-10-19-12)13-9-5-7-11-20-13/h4-11H,1-3H3 |
| InChIKey | NSZQOZRWFVPPGF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|