C18H13FO6 — CID 11484706
(6,7-dimethoxy-2-oxochromen-3-yl) 2-fluorobenzoate (PubChem CID 11484706) has the molecular formula C18H13FO6 and a molecular weight of 344.29 g/mol. Its IUPAC name is (6,7-dimethoxy-2-oxochromen-3-yl) 2-fluorobenzoate.
| Compound Name | (6,7-dimethoxy-2-oxochromen-3-yl) 2-fluorobenzoate |
|---|---|
| PubChem CID | 11484706 |
| Molecular Formula | C18H13FO6 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (6,7-dimethoxy-2-oxochromen-3-yl) 2-fluorobenzoate |
| SMILES | COc1cc2cc(OC(=O)c3ccccc3F)c(=O)oc2cc1OC |
| InChI | InChI=1S/C18H13FO6/c1-22-14-7-10-8-16(18(21)24-13(10)9-15(14)23-2)25-17(20)11-5-3-4-6-12(11)19/h3-9H,1-2H3 |
| InChIKey | NZIQVXUBQMFATP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|