C21H14FNO6 — CID 134144925
(6-methoxy-2-oxochromen-7-yl) 5-(2-fluorophenyl)-3-methyl-1,2-oxazole-4-carboxylate (PubChem CID 134144925) has the molecular formula C21H14FNO6 and a molecular weight of 395.34 g/mol. Its IUPAC name is (6-methoxy-2-oxochromen-7-yl) 5-(2-fluorophenyl)-3-methyl-1,2-oxazole-4-carboxylate.
| Compound Name | (6-methoxy-2-oxochromen-7-yl) 5-(2-fluorophenyl)-3-methyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 134144925 |
| Molecular Formula | C21H14FNO6 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | (6-methoxy-2-oxochromen-7-yl) 5-(2-fluorophenyl)-3-methyl-1,2-oxazole-4-carboxylate |
| SMILES | COc1cc2ccc(=O)oc2cc1OC(=O)c1c(C)noc1-c1ccccc1F |
| InChI | InChI=1S/C21H14FNO6/c1-11-19(20(29-23-11)13-5-3-4-6-14(13)22)21(25)28-17-10-15-12(9-16(17)26-2)7-8-18(24)27-15/h3-10H,1-2H3 |
| InChIKey | ROZPRYAKJIVBKO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 91.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|