C16H27ClN2 — CID 114847920
2-[(tert-butylamino)methyl]-4-chloro-N-ethyl-N-propan-2-ylaniline (PubChem CID 114847920) has the molecular formula C16H27ClN2 and a molecular weight of 282.86 g/mol. Its IUPAC name is 2-[(tert-butylamino)methyl]-4-chloro-N-ethyl-N-propan-2-ylaniline.
| Compound Name | 2-[(tert-butylamino)methyl]-4-chloro-N-ethyl-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 114847920 |
| Molecular Formula | C16H27ClN2 |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 2-[(tert-butylamino)methyl]-4-chloro-N-ethyl-N-propan-2-ylaniline |
| SMILES | CCN(c1ccc(Cl)cc1CNC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H27ClN2/c1-7-19(12(2)3)15-9-8-14(17)10-13(15)11-18-16(4,5)6/h8-10,12,18H,7,11H2,1-6H3 |
| InChIKey | JLGIUTPMWCPPCN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |