C17H29ClN2S — CID 114853812
2-[(tert-butylamino)methyl]-4-chloro-N-methyl-N-(4-methylsulfanylbutan-2-yl)aniline (PubChem CID 114853812) has the molecular formula C17H29ClN2S and a molecular weight of 328.95 g/mol. Its IUPAC name is 2-[(tert-butylamino)methyl]-4-chloro-N-methyl-N-(4-methylsulfanylbutan-2-yl)aniline.
| Compound Name | 2-[(tert-butylamino)methyl]-4-chloro-N-methyl-N-(4-methylsulfanylbutan-2-yl)aniline |
|---|---|
| PubChem CID | 114853812 |
| Molecular Formula | C17H29ClN2S |
| Molecular Weight | 328.95 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-[(tert-butylamino)methyl]-4-chloro-N-methyl-N-(4-methylsulfanylbutan-2-yl)aniline |
| SMILES | CSCCC(C)N(C)c1ccc(Cl)cc1CNC(C)(C)C |
| InChI | InChI=1S/C17H29ClN2S/c1-13(9-10-21-6)20(5)16-8-7-15(18)11-14(16)12-19-17(2,3)4/h7-8,11,13,19H,9-10,12H2,1-6H3 |
| InChIKey | GHANSDAFMYPFFC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.95 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |