C16H21ClFN3 — CID 114849077
2-[4-[(4-chloro-2-fluorophenyl)methyl]piperazin-1-yl]pentanenitrile (PubChem CID 114849077) has the molecular formula C16H21ClFN3 and a molecular weight of 309.82 g/mol. Its IUPAC name is 2-[4-[(4-chloro-2-fluorophenyl)methyl]piperazin-1-yl]pentanenitrile.
| Compound Name | 2-[4-[(4-chloro-2-fluorophenyl)methyl]piperazin-1-yl]pentanenitrile |
|---|---|
| PubChem CID | 114849077 |
| Molecular Formula | C16H21ClFN3 |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[4-[(4-chloro-2-fluorophenyl)methyl]piperazin-1-yl]pentanenitrile |
| SMILES | CCCC(C#N)N1CCN(Cc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C16H21ClFN3/c1-2-3-15(11-19)21-8-6-20(7-9-21)12-13-4-5-14(17)10-16(13)18/h4-5,10,15H,2-3,6-9,12H2,1H3 |
| InChIKey | TUFSBKITPKGDQK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |