C12H15BrClF — CID 114862007
1-[2-(bromomethyl)-3-methylbutyl]-4-chloro-2-fluorobenzene (PubChem CID 114862007) has the molecular formula C12H15BrClF and a molecular weight of 293.61 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3-methylbutyl]-4-chloro-2-fluorobenzene.
| Compound Name | 1-[2-(bromomethyl)-3-methylbutyl]-4-chloro-2-fluorobenzene |
|---|---|
| PubChem CID | 114862007 |
| Molecular Formula | C12H15BrClF |
| Molecular Weight | 293.61 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 1-[2-(bromomethyl)-3-methylbutyl]-4-chloro-2-fluorobenzene |
| SMILES | CC(C)C(CBr)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H15BrClF/c1-8(2)10(7-13)5-9-3-4-11(14)6-12(9)15/h3-4,6,8,10H,5,7H2,1-2H3 |
| InChIKey | RUCSRSICQVVINA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|