C11H13ClO2S — CID 114863755
4-chloro-2-(3-hydroxy-2-methylpropyl)sulfanylbenzaldehyde (PubChem CID 114863755) has the molecular formula C11H13ClO2S and a molecular weight of 244.74 g/mol. Its IUPAC name is 4-chloro-2-(3-hydroxy-2-methylpropyl)sulfanylbenzaldehyde.
| Compound Name | 4-chloro-2-(3-hydroxy-2-methylpropyl)sulfanylbenzaldehyde |
|---|---|
| PubChem CID | 114863755 |
| Molecular Formula | C11H13ClO2S |
| Molecular Weight | 244.74 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 4-chloro-2-(3-hydroxy-2-methylpropyl)sulfanylbenzaldehyde |
| SMILES | CC(CO)CSc1cc(Cl)ccc1C=O |
| InChI | InChI=1S/C11H13ClO2S/c1-8(5-13)7-15-11-4-10(12)3-2-9(11)6-14/h2-4,6,8,13H,5,7H2,1H3 |
| InChIKey | UCBUIQGFVYOJSH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.74 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|