C10H11ClO3S — CID 114863763
4-chloro-2-(2,3-dihydroxypropylsulfanyl)benzaldehyde (PubChem CID 114863763) has the molecular formula C10H11ClO3S and a molecular weight of 246.71 g/mol. Its IUPAC name is 4-chloro-2-(2,3-dihydroxypropylsulfanyl)benzaldehyde.
| Compound Name | 4-chloro-2-(2,3-dihydroxypropylsulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 114863763 |
| Molecular Formula | C10H11ClO3S |
| Molecular Weight | 246.71 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 4-chloro-2-(2,3-dihydroxypropylsulfanyl)benzaldehyde |
| SMILES | O=Cc1ccc(Cl)cc1SCC(O)CO |
| InChI | InChI=1S/C10H11ClO3S/c11-8-2-1-7(4-12)10(3-8)15-6-9(14)5-13/h1-4,9,13-14H,5-6H2 |
| InChIKey | QXQBWDGFFFRNCF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.71 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|