About 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol
4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol (PubChem CID 114865491) has the molecular formula C16H24BrFO
and a molecular weight of 331.27 g/mol. Its IUPAC name is 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol.
Molecular Properties
| Compound Name | 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol |
| PubChem CID | 114865491 |
| Molecular Formula | C16H24BrFO |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol |
| SMILES | CC(C)CC(O)(Cc1cc(F)cc(Br)c1)CC(C)C |
| InChI | InChI=1S/C16H24BrFO/c1-11(2)8-16(19,9-12(3)4)10-13-5-14(17)7-15(18)6-13/h5-7,11-12,19H,8-10H2,1-4H3 |
| InChIKey | MYBUKVQJHGJLBW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol?
The IUPAC name of 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol (CID 114865491) is 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol.
What is the SMILES notation for 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol?
The canonical SMILES for 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol is CC(C)CC(O)(Cc1cc(F)cc(Br)c1)CC(C)C.
What is the InChIKey of 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol?
The InChIKey is MYBUKVQJHGJLBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24BrFO/c1-11(2)8-16(19,9-12(3)4)10-13-5-14(17)7-15(18)6-13/h5-7,11-12,19H,8-10H2,1-4H3.
What are the key properties of 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol?
4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol has a molecular weight of 331.27 g/mol, XLogP of 4.95, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol is sourced from PubChem (CID 114865491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).