C16H24BrFO — CID 114865491
4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol (PubChem CID 114865491) has the molecular formula C16H24BrFO and a molecular weight of 331.27 g/mol. Its IUPAC name is 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol.
| Compound Name | 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol |
|---|---|
| PubChem CID | 114865491 |
| Molecular Formula | C16H24BrFO |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-[(3-bromo-5-fluorophenyl)methyl]-2,6-dimethylheptan-4-ol |
| SMILES | CC(C)CC(O)(Cc1cc(F)cc(Br)c1)CC(C)C |
| InChI | InChI=1S/C16H24BrFO/c1-11(2)8-16(19,9-12(3)4)10-13-5-14(17)7-15(18)6-13/h5-7,11-12,19H,8-10H2,1-4H3 |
| InChIKey | MYBUKVQJHGJLBW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |