C15H14BrF2NO — CID 115940685
1-(3-bromo-5-fluorophenyl)-2-(5-fluoro-2-pyridinyl)butan-2-ol (PubChem CID 115940685) has the molecular formula C15H14BrF2NO and a molecular weight of 342.18 g/mol. Its IUPAC name is 1-(3-bromo-5-fluorophenyl)-2-(5-fluoro-2-pyridinyl)butan-2-ol.
| Compound Name | 1-(3-bromo-5-fluorophenyl)-2-(5-fluoro-2-pyridinyl)butan-2-ol |
|---|---|
| PubChem CID | 115940685 |
| Molecular Formula | C15H14BrF2NO |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 1-(3-bromo-5-fluorophenyl)-2-(5-fluoro-2-pyridinyl)butan-2-ol |
| SMILES | CCC(O)(Cc1cc(F)cc(Br)c1)c1ccc(F)cn1 |
| InChI | InChI=1S/C15H14BrF2NO/c1-2-15(20,14-4-3-12(17)9-19-14)8-10-5-11(16)7-13(18)6-10/h3-7,9,20H,2,8H2,1H3 |
| InChIKey | YEIFQQXMGKJCDS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |