C13H16BrFO2 — CID 79702744
2-[(3-bromo-5-fluorophenyl)methyl]-2-ethylbutanoic acid (PubChem CID 79702744) has the molecular formula C13H16BrFO2 and a molecular weight of 303.17 g/mol. Its IUPAC name is 2-[(3-bromo-5-fluorophenyl)methyl]-2-ethylbutanoic acid.
| Compound Name | 2-[(3-bromo-5-fluorophenyl)methyl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 79702744 |
| Molecular Formula | C13H16BrFO2 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-[(3-bromo-5-fluorophenyl)methyl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(Cc1cc(F)cc(Br)c1)C(=O)O |
| InChI | InChI=1S/C13H16BrFO2/c1-3-13(4-2,12(16)17)8-9-5-10(14)7-11(15)6-9/h5-7H,3-4,8H2,1-2H3,(H,16,17) |
| InChIKey | FRDXYJZCIDNUBM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |