C12H29N3 — CID 114867859
2-(2,2-dimethylhydrazinyl)-4-methyl-2-(2-methylpropyl)pentan-1-amine (PubChem CID 114867859) has the molecular formula C12H29N3 and a molecular weight of 215.38 g/mol. Its IUPAC name is 2-(2,2-dimethylhydrazinyl)-4-methyl-2-(2-methylpropyl)pentan-1-amine.
| Compound Name | 2-(2,2-dimethylhydrazinyl)-4-methyl-2-(2-methylpropyl)pentan-1-amine |
|---|---|
| PubChem CID | 114867859 |
| Molecular Formula | C12H29N3 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.24 |
| IUPAC Name | 2-(2,2-dimethylhydrazinyl)-4-methyl-2-(2-methylpropyl)pentan-1-amine |
| SMILES | CC(C)CC(CN)(CC(C)C)NN(C)C |
| InChI | InChI=1S/C12H29N3/c1-10(2)7-12(9-13,8-11(3)4)14-15(5)6/h10-11,14H,7-9,13H2,1-6H3 |
| InChIKey | GFZHAJYMWYJSKK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|