C11H22F3N — CID 114868730
N,2,6-trimethyl-4-(trifluoromethyl)heptan-4-amine (PubChem CID 114868730) has the molecular formula C11H22F3N and a molecular weight of 225.30 g/mol. Its IUPAC name is N,2,6-trimethyl-4-(trifluoromethyl)heptan-4-amine.
| Compound Name | N,2,6-trimethyl-4-(trifluoromethyl)heptan-4-amine |
|---|---|
| PubChem CID | 114868730 |
| Molecular Formula | C11H22F3N |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | N,2,6-trimethyl-4-(trifluoromethyl)heptan-4-amine |
| SMILES | CNC(CC(C)C)(CC(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H22F3N/c1-8(2)6-10(15-5,7-9(3)4)11(12,13)14/h8-9,15H,6-7H2,1-5H3 |
| InChIKey | CMKTVIQPNBIFEV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |