C13H18FNO2S — CID 114873006
3-(3-fluorophenyl)-2,6-dimethyl-1,4-thiazepane 1,1-dioxide (PubChem CID 114873006) has the molecular formula C13H18FNO2S and a molecular weight of 271.36 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-2,6-dimethyl-1,4-thiazepane 1,1-dioxide.
| Compound Name | 3-(3-fluorophenyl)-2,6-dimethyl-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 114873006 |
| Molecular Formula | C13H18FNO2S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3-(3-fluorophenyl)-2,6-dimethyl-1,4-thiazepane 1,1-dioxide |
| SMILES | CC1CNC(c2cccc(F)c2)C(C)S(=O)(=O)C1 |
| InChI | InChI=1S/C13H18FNO2S/c1-9-7-15-13(10(2)18(16,17)8-9)11-4-3-5-12(14)6-11/h3-6,9-10,13,15H,7-8H2,1-2H3 |
| InChIKey | XRXVBOYCCARBAN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |