C9H15NO2 — CID 114877640
[5-(2-methylbutyl)-1,3-oxazol-4-yl]methanol (PubChem CID 114877640) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is [5-(2-methylbutyl)-1,3-oxazol-4-yl]methanol.
| Compound Name | [5-(2-methylbutyl)-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 114877640 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | [5-(2-methylbutyl)-1,3-oxazol-4-yl]methanol |
| SMILES | CCC(C)Cc1ocnc1CO |
| InChI | InChI=1S/C9H15NO2/c1-3-7(2)4-9-8(5-11)10-6-12-9/h6-7,11H,3-5H2,1-2H3 |
| InChIKey | BRPHYGFNRIZSBK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |