C6H9NO3 — CID 71653314
(5-ethoxy-1,3-oxazol-4-yl)methanol (PubChem CID 71653314) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is (5-ethoxy-1,3-oxazol-4-yl)methanol.
| Compound Name | (5-ethoxy-1,3-oxazol-4-yl)methanol |
|---|---|
| PubChem CID | 71653314 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | (5-ethoxy-1,3-oxazol-4-yl)methanol |
| SMILES | CCOc1ocnc1CO |
| InChI | InChI=1S/C6H9NO3/c1-2-9-6-5(3-8)7-4-10-6/h4,8H,2-3H2,1H3 |
| InChIKey | GXYARILXOVCWMD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |