C18H16N2O2S — CID 134870982
5-ethoxy-N,N-diphenyl-1,3-oxazole-4-carbothioamide (PubChem CID 134870982) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 5-ethoxy-N,N-diphenyl-1,3-oxazole-4-carbothioamide.
| Compound Name | 5-ethoxy-N,N-diphenyl-1,3-oxazole-4-carbothioamide |
|---|---|
| PubChem CID | 134870982 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 5-ethoxy-N,N-diphenyl-1,3-oxazole-4-carbothioamide |
| SMILES | CCOc1ocnc1C(=S)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O2S/c1-2-21-18-16(19-13-22-18)17(23)20(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13H,2H2,1H3 |
| InChIKey | FSCYLFNUUUUZOR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|