C6H7NO3 — CID 88707146
5-ethoxy-1,3-oxazole-4-carbaldehyde (PubChem CID 88707146) has the molecular formula C6H7NO3 and a molecular weight of 141.13 g/mol. Its IUPAC name is 5-ethoxy-1,3-oxazole-4-carbaldehyde.
| Compound Name | 5-ethoxy-1,3-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 88707146 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 5-ethoxy-1,3-oxazole-4-carbaldehyde |
| SMILES | CCOc1ocnc1C=O |
| InChI | InChI=1S/C6H7NO3/c1-2-9-6-5(3-8)7-4-10-6/h3-4H,2H2,1H3 |
| InChIKey | UAPBKVJNLJGZTM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|