C12H13NO3 — CID 79145618
[5-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methanol (PubChem CID 79145618) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is [5-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methanol.
| Compound Name | [5-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 79145618 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | [5-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methanol |
| SMILES | CCOc1ccc(-c2ocnc2CO)cc1 |
| InChI | InChI=1S/C12H13NO3/c1-2-15-10-5-3-9(4-6-10)12-11(7-14)13-8-16-12/h3-6,8,14H,2,7H2,1H3 |
| InChIKey | HOXKFAWYIXWNQS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |