C13H16N2O2 — CID 94685630
2-[4-(4-ethoxyphenyl)-1,3-oxazol-5-yl]ethanamine (PubChem CID 94685630) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-[4-(4-ethoxyphenyl)-1,3-oxazol-5-yl]ethanamine.
| Compound Name | 2-[4-(4-ethoxyphenyl)-1,3-oxazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 94685630 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-[4-(4-ethoxyphenyl)-1,3-oxazol-5-yl]ethanamine |
| SMILES | CCOc1ccc(-c2ncoc2CCN)cc1 |
| InChI | InChI=1S/C13H16N2O2/c1-2-16-11-5-3-10(4-6-11)13-12(7-8-14)17-9-15-13/h3-6,9H,2,7-8,14H2,1H3 |
| InChIKey | BLTIFMHUTKVMRS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |