C12H13FN2O — CID 82127608
2-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]ethanamine (PubChem CID 82127608) has the molecular formula C12H13FN2O and a molecular weight of 220.25 g/mol. Its IUPAC name is 2-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]ethanamine.
| Compound Name | 2-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 82127608 |
| Molecular Formula | C12H13FN2O |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]ethanamine |
| SMILES | Cc1cc(-c2ncoc2CCN)ccc1F |
| InChI | InChI=1S/C12H13FN2O/c1-8-6-9(2-3-10(8)13)12-11(4-5-14)16-7-15-12/h2-3,6-7H,4-5,14H2,1H3 |
| InChIKey | WPMYUVYGIWYMQG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |