About 3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid
3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid (PubChem CID 82131272) has the molecular formula C13H12FNO3
and a molecular weight of 249.24 g/mol. Its IUPAC name is 3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid.
Analyze 3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid?
The IUPAC name of 3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid (CID 82131272) is 3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid.
What is the SMILES notation for 3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid?
The canonical SMILES for 3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid is Cc1cc(-c2ncoc2CCC(=O)O)ccc1F.
What is the InChIKey of 3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid?
The InChIKey is VRQPTTJHLUTMDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNO3/c1-8-6-9(2-3-10(8)14)13-11(18-7-15-13)4-5-12(16)17/h2-3,6-7H,4-5H2,1H3,(H,16,17).
What are the key properties of 3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid?
3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid has a molecular weight of 249.24 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-fluoro-3-methylphenyl)-1,3-oxazol-5-yl]propanoic acid is sourced from PubChem (CID 82131272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).