2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid

C13H13NO3 — CID 82128624

IUPAC2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid
SMILESCc1ccc(-c2ncoc2CC(=O)O)cc1C
InChIInChI=1S/C13H13NO3/c1-8-3-4-10(5-9(8)2)13-11(6-12(15)16)17-7-14-13/h3-5,7H,6H2,1-2H3,(H,15,16)
InChIKeyLNSCLCPLRRFYGO-UHFFFAOYSA-N
MW231.25 g/mol
LogP2.59
Rot. Bonds3

About 2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid

2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid (PubChem CID 82128624) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid
PubChem CID82128624
Molecular FormulaC13H13NO3
Molecular Weight231.25 g/mol
Exact Mass231.09
IUPAC Name2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid
SMILESCc1ccc(-c2ncoc2CC(=O)O)cc1C
InChIInChI=1S/C13H13NO3/c1-8-3-4-10(5-9(8)2)13-11(6-12(15)16)17-7-14-13/h3-5,7H,6H2,1-2H3,(H,15,16)
InChIKeyLNSCLCPLRRFYGO-UHFFFAOYSA-N
XLogP2.59
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 52.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid?
The IUPAC name of 2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid (CID 82128624) is 2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid.
What is the SMILES notation for 2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid?
The canonical SMILES for 2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid is Cc1ccc(-c2ncoc2CC(=O)O)cc1C.
What is the InChIKey of 2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid?
The InChIKey is LNSCLCPLRRFYGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-8-3-4-10(5-9(8)2)13-11(6-12(15)16)17-7-14-13/h3-5,7H,6H2,1-2H3,(H,15,16).
What are the key properties of 2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid?
2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid has a molecular weight of 231.25 g/mol, XLogP of 2.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-dimethylphenyl)-1,3-oxazol-5-yl]acetic acid is sourced from PubChem (CID 82128624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).