C10H5F2NO3 — CID 82287519
4-(3,4-difluorophenyl)-1,3-oxazole-5-carboxylic acid (PubChem CID 82287519) has the molecular formula C10H5F2NO3 and a molecular weight of 225.15 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-1,3-oxazole-5-carboxylic acid.
| Compound Name | 4-(3,4-difluorophenyl)-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82287519 |
| Molecular Formula | C10H5F2NO3 |
| Molecular Weight | 225.15 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 4-(3,4-difluorophenyl)-1,3-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1ocnc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H5F2NO3/c11-6-2-1-5(3-7(6)12)8-9(10(14)15)16-4-13-8/h1-4H,(H,14,15) |
| InChIKey | OITIRDYJXMPGNT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.15 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |