C16H18O2 — CID 163529094
2-[4-(3,4-dimethylphenyl)cyclohexa-1,3-dien-1-yl]acetic acid (PubChem CID 163529094) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-[4-(3,4-dimethylphenyl)cyclohexa-1,3-dien-1-yl]acetic acid.
| Compound Name | 2-[4-(3,4-dimethylphenyl)cyclohexa-1,3-dien-1-yl]acetic acid |
|---|---|
| PubChem CID | 163529094 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-[4-(3,4-dimethylphenyl)cyclohexa-1,3-dien-1-yl]acetic acid |
| SMILES | Cc1ccc(C2=CC=C(CC(=O)O)CC2)cc1C |
| InChI | InChI=1S/C16H18O2/c1-11-3-6-15(9-12(11)2)14-7-4-13(5-8-14)10-16(17)18/h3-4,6-7,9H,5,8,10H2,1-2H3,(H,17,18) |
| InChIKey | DRJFTGTVAVBWQK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |