C19H27NO3 — CID 54846736
[4-methyl-5-(4-octoxyphenyl)-1,2-oxazol-3-yl]methanol (PubChem CID 54846736) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is [4-methyl-5-(4-octoxyphenyl)-1,2-oxazol-3-yl]methanol.
| Compound Name | [4-methyl-5-(4-octoxyphenyl)-1,2-oxazol-3-yl]methanol |
|---|---|
| PubChem CID | 54846736 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [4-methyl-5-(4-octoxyphenyl)-1,2-oxazol-3-yl]methanol |
| SMILES | CCCCCCCCOc1ccc(-c2onc(CO)c2C)cc1 |
| InChI | InChI=1S/C19H27NO3/c1-3-4-5-6-7-8-13-22-17-11-9-16(10-12-17)19-15(2)18(14-21)20-23-19/h9-12,21H,3-8,13-14H2,1-2H3 |
| InChIKey | FIEAGRXZPXKHKY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|