C15H19NO2 — CID 166514076
5-(4-hexoxyphenyl)-1,2-oxazole (PubChem CID 166514076) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 5-(4-hexoxyphenyl)-1,2-oxazole.
| Compound Name | 5-(4-hexoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 166514076 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 5-(4-hexoxyphenyl)-1,2-oxazole |
| SMILES | CCCCCCOc1ccc(-c2ccno2)cc1 |
| InChI | InChI=1S/C15H19NO2/c1-2-3-4-5-12-17-14-8-6-13(7-9-14)15-10-11-16-18-15/h6-11H,2-5,12H2,1H3 |
| InChIKey | GBIGNZPHSZDEIW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|