C26H42O7Si — CID 11488796
[(2R,3R,4aR,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2,2-dimethylpropanoyloxy)-1,4-dioxo-2,3,4a,5,8,8a-hexahydronaphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 11488796) has the molecular formula C26H42O7Si and a molecular weight of 494.70 g/mol. Its IUPAC name is [(2R,3R,4aR,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2,2-dimethylpropanoyloxy)-1,4-dioxo-2,3,4a,5,8,8a-hexahydronaphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4aR,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2,2-dimethylpropanoyloxy)-1,4-dioxo-2,3,4a,5,8,8a-hexahydronaphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11488796 |
| Molecular Formula | C26H42O7Si |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | [(2R,3R,4aR,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-3-(2,2-dimethylpropanoyloxy)-1,4-dioxo-2,3,4a,5,8,8a-hexahydronaphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1C(=O)[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C=CC[C@H]2C(=O)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C26H42O7Si/c1-24(2,3)22(29)31-20-18(27)15-13-12-14-16(33-34(10,11)26(7,8)9)17(15)19(28)21(20)32-23(30)25(4,5)6/h12,14-17,20-21H,13H2,1-11H3/t15-,16+,17-,20+,21+/m1/s1 |
| InChIKey | PFBWNSLAMNKYSZ-VKBFCKQYSA-N |
| XLogP | 4.64 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|