C21H32O7Si — CID 11015416
methyl (4aS,7R,8aS)-4a-(acetyloxymethyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,8-dioxo-3,4,7,8a-tetrahydro-1H-naphthalene-1-carboxylate (PubChem CID 11015416) has the molecular formula C21H32O7Si and a molecular weight of 424.57 g/mol. Its IUPAC name is methyl (4aS,7R,8aS)-4a-(acetyloxymethyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,8-dioxo-3,4,7,8a-tetrahydro-1H-naphthalene-1-carboxylate.
| Compound Name | methyl (4aS,7R,8aS)-4a-(acetyloxymethyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,8-dioxo-3,4,7,8a-tetrahydro-1H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11015416 |
| Molecular Formula | C21H32O7Si |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | methyl (4aS,7R,8aS)-4a-(acetyloxymethyl)-7-[tert-butyl(dimethyl)silyl]oxy-2,8-dioxo-3,4,7,8a-tetrahydro-1H-naphthalene-1-carboxylate |
| SMILES | COC(=O)C1C(=O)CC[C@]2(COC(C)=O)C=C[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C21H32O7Si/c1-13(22)27-12-21-10-8-14(23)16(19(25)26-5)17(21)18(24)15(9-11-21)28-29(6,7)20(2,3)4/h9,11,15-17H,8,10,12H2,1-7H3/t15-,16?,17-,21-/m1/s1 |
| InChIKey | BKAIZRFTYKYRCR-AJHYPVTESA-N |
| XLogP | 2.83 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|