C23H36O4Si — CID 132819222
methyl (1R,4R,4aR,8aR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-2-ynyl]-4-methyl-8-oxo-1,4,5,6,7,8a-hexahydronaphthalene-4a-carboxylate (PubChem CID 132819222) has the molecular formula C23H36O4Si and a molecular weight of 404.62 g/mol. Its IUPAC name is methyl (1R,4R,4aR,8aR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-2-ynyl]-4-methyl-8-oxo-1,4,5,6,7,8a-hexahydronaphthalene-4a-carboxylate.
| Compound Name | methyl (1R,4R,4aR,8aR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-2-ynyl]-4-methyl-8-oxo-1,4,5,6,7,8a-hexahydronaphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 132819222 |
| Molecular Formula | C23H36O4Si |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | methyl (1R,4R,4aR,8aR)-1-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybut-2-ynyl]-4-methyl-8-oxo-1,4,5,6,7,8a-hexahydronaphthalene-4a-carboxylate |
| SMILES | CC#C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C=C[C@@H](C)[C@]2(C(=O)OC)CCCC(=O)[C@H]12 |
| InChI | InChI=1S/C23H36O4Si/c1-9-11-19(27-28(7,8)22(3,4)5)17-14-13-16(2)23(21(25)26-6)15-10-12-18(24)20(17)23/h13-14,16-17,19-20H,10,12,15H2,1-8H3/t16-,17+,19+,20+,23-/m1/s1 |
| InChIKey | PEZHMKVALUJUCF-ZTNCBQQFSA-N |
| XLogP | 4.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|