C16H15BrN2O2 — CID 114889839
6-[2-(aminomethyl)-4-bromophenoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 114889839) has the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. Its IUPAC name is 6-[2-(aminomethyl)-4-bromophenoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-(aminomethyl)-4-bromophenoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 114889839 |
| Molecular Formula | C16H15BrN2O2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 6-[2-(aminomethyl)-4-bromophenoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | NCc1cc(Br)ccc1Oc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C16H15BrN2O2/c17-12-2-5-15(11(7-12)9-18)21-13-3-4-14-10(8-13)1-6-16(20)19-14/h2-5,7-8H,1,6,9,18H2,(H,19,20) |
| InChIKey | BNJGBDLKWLULKD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |