C14H19BrN2O3 — CID 114890050
methyl 2-(4-bromo-2-carbamoylanilino)-4-methylpentanoate (PubChem CID 114890050) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is methyl 2-(4-bromo-2-carbamoylanilino)-4-methylpentanoate.
| Compound Name | methyl 2-(4-bromo-2-carbamoylanilino)-4-methylpentanoate |
|---|---|
| PubChem CID | 114890050 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | methyl 2-(4-bromo-2-carbamoylanilino)-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)Nc1ccc(Br)cc1C(N)=O |
| InChI | InChI=1S/C14H19BrN2O3/c1-8(2)6-12(14(19)20-3)17-11-5-4-9(15)7-10(11)13(16)18/h4-5,7-8,12,17H,6H2,1-3H3,(H2,16,18) |
| InChIKey | HUMHOERPOZFCEX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |