C14H22BrN3O — CID 114894172
2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-bromobenzamide (PubChem CID 114894172) has the molecular formula C14H22BrN3O and a molecular weight of 328.25 g/mol. Its IUPAC name is 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-bromobenzamide.
| Compound Name | 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-bromobenzamide |
|---|---|
| PubChem CID | 114894172 |
| Molecular Formula | C14H22BrN3O |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-5-bromobenzamide |
| SMILES | CC(C)CC(C)(CN)Nc1ccc(Br)cc1C(N)=O |
| InChI | InChI=1S/C14H22BrN3O/c1-9(2)7-14(3,8-16)18-12-5-4-10(15)6-11(12)13(17)19/h4-6,9,18H,7-8,16H2,1-3H3,(H2,17,19) |
| InChIKey | LZDFIFOAEVLGSN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |