About 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide
2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide (PubChem CID 115310251) has the molecular formula C14H22ClN3O
and a molecular weight of 283.80 g/mol. Its IUPAC name is 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide.
Molecular Properties
| Compound Name | 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide |
| PubChem CID | 115310251 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide |
| SMILES | CC(C)CC(C)(CN)Nc1cccc(Cl)c1C(N)=O |
| InChI | InChI=1S/C14H22ClN3O/c1-9(2)7-14(3,8-16)18-11-6-4-5-10(15)12(11)13(17)19/h4-6,9,18H,7-8,16H2,1-3H3,(H2,17,19) |
| InChIKey | XIPRJIMJFNFWTI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide?
The IUPAC name of 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide (CID 115310251) is 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide.
What is the SMILES notation for 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide?
The canonical SMILES for 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide is CC(C)CC(C)(CN)Nc1cccc(Cl)c1C(N)=O.
What is the InChIKey of 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide?
The InChIKey is XIPRJIMJFNFWTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22ClN3O/c1-9(2)7-14(3,8-16)18-11-6-4-5-10(15)12(11)13(17)19/h4-6,9,18H,7-8,16H2,1-3H3,(H2,17,19).
What are the key properties of 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide?
2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide has a molecular weight of 283.80 g/mol, XLogP of 2.61, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-amino-2,4-dimethylpentan-2-yl)amino]-6-chlorobenzamide is sourced from PubChem (CID 115310251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).