C17H17BrN2S — CID 114891692
5-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)benzenecarbothioamide (PubChem CID 114891692) has the molecular formula C17H17BrN2S and a molecular weight of 361.31 g/mol. Its IUPAC name is 5-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)benzenecarbothioamide.
| Compound Name | 5-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 114891692 |
| Molecular Formula | C17H17BrN2S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 5-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1cc(Br)ccc1NC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H17BrN2S/c18-12-8-9-16(14(10-12)17(19)21)20-15-7-3-5-11-4-1-2-6-13(11)15/h1-2,4,6,8-10,15,20H,3,5,7H2,(H2,19,21) |
| InChIKey | CTMNEQUIPMUDSK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|