5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid

C9H5BrN2O2S2 — CID 114896284

IUPAC5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid
SMILESO=C(O)c1cc(Br)ccc1Sc1ncns1
InChIInChI=1S/C9H5BrN2O2S2/c10-5-1-2-7(6(3-5)8(13)14)15-9-11-4-12-16-9/h1-4H,(H,13,14)
InChIKeyIVZNUEGAOZPTHA-UHFFFAOYSA-N
MW317.19 g/mol
LogP3.15
Rot. Bonds3

About 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid

5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid (PubChem CID 114896284) has the molecular formula C9H5BrN2O2S2 and a molecular weight of 317.19 g/mol. Its IUPAC name is 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid.

Molecular Properties

Compound Name5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid
PubChem CID114896284
Molecular FormulaC9H5BrN2O2S2
Molecular Weight317.19 g/mol
Exact Mass315.90
IUPAC Name5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid
SMILESO=C(O)c1cc(Br)ccc1Sc1ncns1
InChIInChI=1S/C9H5BrN2O2S2/c10-5-1-2-7(6(3-5)8(13)14)15-9-11-4-12-16-9/h1-4H,(H,13,14)
InChIKeyIVZNUEGAOZPTHA-UHFFFAOYSA-N
XLogP3.15
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.19
LogP ≤ 53.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid?
The IUPAC name of 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid (CID 114896284) is 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid.
What is the SMILES notation for 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid?
The canonical SMILES for 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid is O=C(O)c1cc(Br)ccc1Sc1ncns1.
What is the InChIKey of 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid?
The InChIKey is IVZNUEGAOZPTHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrN2O2S2/c10-5-1-2-7(6(3-5)8(13)14)15-9-11-4-12-16-9/h1-4H,(H,13,14).
What are the key properties of 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid?
5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid has a molecular weight of 317.19 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid is sourced from PubChem (CID 114896284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).