C9H5BrN2O2S2 — CID 114896284
5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid (PubChem CID 114896284) has the molecular formula C9H5BrN2O2S2 and a molecular weight of 317.19 g/mol. Its IUPAC name is 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid.
| Compound Name | 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 114896284 |
| Molecular Formula | C9H5BrN2O2S2 |
| Molecular Weight | 317.19 g/mol |
| Exact Mass | 315.90 |
| IUPAC Name | 5-bromo-2-(1,2,4-thiadiazol-5-ylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1cc(Br)ccc1Sc1ncns1 |
| InChI | InChI=1S/C9H5BrN2O2S2/c10-5-1-2-7(6(3-5)8(13)14)15-9-11-4-12-16-9/h1-4H,(H,13,14) |
| InChIKey | IVZNUEGAOZPTHA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.19 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |