C14H16O4S — CID 114899475
2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-3-methoxy-2-methyl-3-oxopropanoic acid (PubChem CID 114899475) has the molecular formula C14H16O4S and a molecular weight of 280.34 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-3-methoxy-2-methyl-3-oxopropanoic acid.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-3-methoxy-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114899475 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-3-methoxy-2-methyl-3-oxopropanoic acid |
| SMILES | COC(=O)C(C)(CC1CSc2ccccc21)C(=O)O |
| InChI | InChI=1S/C14H16O4S/c1-14(12(15)16,13(17)18-2)7-9-8-19-11-6-4-3-5-10(9)11/h3-6,9H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | JACRIGFCFOSDPS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|