C16H21BrN2O — CID 114902117
4-bromo-2-[(2,2-diethyloxan-4-yl)amino]benzonitrile (PubChem CID 114902117) has the molecular formula C16H21BrN2O and a molecular weight of 337.26 g/mol. Its IUPAC name is 4-bromo-2-[(2,2-diethyloxan-4-yl)amino]benzonitrile.
| Compound Name | 4-bromo-2-[(2,2-diethyloxan-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 114902117 |
| Molecular Formula | C16H21BrN2O |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-bromo-2-[(2,2-diethyloxan-4-yl)amino]benzonitrile |
| SMILES | CCC1(CC)CC(Nc2cc(Br)ccc2C#N)CCO1 |
| InChI | InChI=1S/C16H21BrN2O/c1-3-16(4-2)10-14(7-8-20-16)19-15-9-13(17)6-5-12(15)11-18/h5-6,9,14,19H,3-4,7-8,10H2,1-2H3 |
| InChIKey | BCXHKHKBMHEFDA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |